C16H19N5O2 — CID 136586988
(3R)-3-ethyl-4-(2-pyrazol-1-ylpyridine-4-carbonyl)-1,4-diazepan-2-one (PubChem CID 136586988) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (3R)-3-ethyl-4-(2-pyrazol-1-ylpyridine-4-carbonyl)-1,4-diazepan-2-one.
| Compound Name | (3R)-3-ethyl-4-(2-pyrazol-1-ylpyridine-4-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 136586988 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (3R)-3-ethyl-4-(2-pyrazol-1-ylpyridine-4-carbonyl)-1,4-diazepan-2-one |
| SMILES | CC[C@@H]1C(=O)NCCCN1C(=O)c1ccnc(-n2cccn2)c1 |
| InChI | InChI=1S/C16H19N5O2/c1-2-13-15(22)18-6-3-9-20(13)16(23)12-5-8-17-14(11-12)21-10-4-7-19-21/h4-5,7-8,10-11,13H,2-3,6,9H2,1H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | CODSLHRFDOLQLD-CYBMUJFWSA-N |
| XLogP | 1.01 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |