C12H13BrN2O2 — CID 138017487
(1R)-1-(4-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)ethanol (PubChem CID 138017487) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is (1R)-1-(4-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)ethanol.
| Compound Name | (1R)-1-(4-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 138017487 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (1R)-1-(4-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)ethanol |
| SMILES | O[C@@H](CNCc1ccon1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrN2O2/c13-10-3-1-9(2-4-10)12(16)8-14-7-11-5-6-17-15-11/h1-6,12,14,16H,7-8H2/t12-/m0/s1 |
| InChIKey | ADKAHBIOODDSKT-LBPRGKRZSA-N |
| XLogP | 2.26 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |