C10H11ClF3N5 — CID 138018656
N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-methyl-5-(trifluoromethyl)pyrazol-3-amine (PubChem CID 138018656) has the molecular formula C10H11ClF3N5 and a molecular weight of 293.68 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-methyl-5-(trifluoromethyl)pyrazol-3-amine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-methyl-5-(trifluoromethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 138018656 |
| Molecular Formula | C10H11ClF3N5 |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-methyl-5-(trifluoromethyl)pyrazol-3-amine |
| SMILES | Cn1nc(NCc2ncc(Cl)n2C)cc1C(F)(F)F |
| InChI | InChI=1S/C10H11ClF3N5/c1-18-7(11)4-16-9(18)5-15-8-3-6(10(12,13)14)19(2)17-8/h3-4H,5H2,1-2H3,(H,15,17) |
| InChIKey | ZXIGIASWASQGJB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |