C18H24N6O — CID 138018829
1-(1-pyridazin-3-ylpiperidin-4-yl)-3-(1-pyridin-3-ylpropan-2-yl)urea (PubChem CID 138018829) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(1-pyridazin-3-ylpiperidin-4-yl)-3-(1-pyridin-3-ylpropan-2-yl)urea.
| Compound Name | 1-(1-pyridazin-3-ylpiperidin-4-yl)-3-(1-pyridin-3-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 138018829 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-(1-pyridazin-3-ylpiperidin-4-yl)-3-(1-pyridin-3-ylpropan-2-yl)urea |
| SMILES | CC(Cc1cccnc1)NC(=O)NC1CCN(c2cccnn2)CC1 |
| InChI | InChI=1S/C18H24N6O/c1-14(12-15-4-2-8-19-13-15)21-18(25)22-16-6-10-24(11-7-16)17-5-3-9-20-23-17/h2-5,8-9,13-14,16H,6-7,10-12H2,1H3,(H2,21,22,25) |
| InChIKey | JWQVLYZQPKNPCR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |