C17H26N6O2 — CID 154736160
1-cyclohexyl-3-[2-oxo-2-(4-pyridazin-3-ylpiperazin-1-yl)ethyl]urea (PubChem CID 154736160) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-oxo-2-(4-pyridazin-3-ylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-oxo-2-(4-pyridazin-3-ylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 154736160 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-oxo-2-(4-pyridazin-3-ylpiperazin-1-yl)ethyl]urea |
| SMILES | O=C(NCC(=O)N1CCN(c2cccnn2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C17H26N6O2/c24-16(13-18-17(25)20-14-5-2-1-3-6-14)23-11-9-22(10-12-23)15-7-4-8-19-21-15/h4,7-8,14H,1-3,5-6,9-13H2,(H2,18,20,25) |
| InChIKey | RZZPTYBEBRMVLR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |