C14H24N4O3 — CID 112991840
1-cyclohexyl-3-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]urea (PubChem CID 112991840) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 112991840 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-cyclohexyl-3-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]urea |
| SMILES | O=CN1CCN(C(=O)CNC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C14H24N4O3/c19-11-17-6-8-18(9-7-17)13(20)10-15-14(21)16-12-4-2-1-3-5-12/h11-12H,1-10H2,(H2,15,16,21) |
| InChIKey | NTMYYZMGXPNOTR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|