C13H23N3O3 — CID 47277900
1-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)urea (PubChem CID 47277900) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)urea.
| Compound Name | 1-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)urea |
|---|---|
| PubChem CID | 47277900 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)urea |
| SMILES | O=C(NCC(=O)N1CCOCC1)NC1CCCCC1 |
| InChI | InChI=1S/C13H23N3O3/c17-12(16-6-8-19-9-7-16)10-14-13(18)15-11-4-2-1-3-5-11/h11H,1-10H2,(H2,14,15,18) |
| InChIKey | SSESHVWGFRBHHV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |