C20H25N3O2 — CID 138022360
N-[(3aR,7aS)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 138022360) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(3aR,7aS)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(3aR,7aS)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 138022360 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[(3aR,7aS)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC2CC[C@@H]3CN(Cc4ccccc4)C[C@@H]3C2)co1 |
| InChI | InChI=1S/C20H25N3O2/c1-14-21-19(13-25-14)20(24)22-18-8-7-16-11-23(12-17(16)9-18)10-15-5-3-2-4-6-15/h2-6,13,16-18H,7-12H2,1H3,(H,22,24)/t16-,17+,18?/m1/s1 |
| InChIKey | ISCVRPBVXNYVAO-DVKDBIPTSA-N |
| XLogP | 3.01 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |