C15H19N3O3S — CID 138022724
3-[(1,1-dioxothian-4-yl)amino]-1-ethylquinoxalin-2-one (PubChem CID 138022724) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)amino]-1-ethylquinoxalin-2-one.
| Compound Name | 3-[(1,1-dioxothian-4-yl)amino]-1-ethylquinoxalin-2-one |
|---|---|
| PubChem CID | 138022724 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)amino]-1-ethylquinoxalin-2-one |
| SMILES | CCn1c(=O)c(NC2CCS(=O)(=O)CC2)nc2ccccc21 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-18-13-6-4-3-5-12(13)17-14(15(18)19)16-11-7-9-22(20,21)10-8-11/h3-6,11H,2,7-10H2,1H3,(H,16,17) |
| InChIKey | KBJBDYDRTPIQND-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |