C15H21N3O2S — CID 43614991
N-[1-(1-methylbenzimidazol-2-yl)ethyl]-1,1-dioxothian-4-amine (PubChem CID 43614991) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-[1-(1-methylbenzimidazol-2-yl)ethyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[1-(1-methylbenzimidazol-2-yl)ethyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43614991 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[1-(1-methylbenzimidazol-2-yl)ethyl]-1,1-dioxothian-4-amine |
| SMILES | CC(NC1CCS(=O)(=O)CC1)c1nc2ccccc2n1C |
| InChI | InChI=1S/C15H21N3O2S/c1-11(16-12-7-9-21(19,20)10-8-12)15-17-13-5-3-4-6-14(13)18(15)2/h3-6,11-12,16H,7-10H2,1-2H3 |
| InChIKey | YZIILHZGSPBSNQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |