C17H25N3 — CID 81396604
(1R)-1-cyclopentyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]ethanamine (PubChem CID 81396604) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is (1R)-1-cyclopentyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]ethanamine.
| Compound Name | (1R)-1-cyclopentyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 81396604 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | (1R)-1-cyclopentyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]ethanamine |
| SMILES | CC(N[C@H](C)C1CCCC1)c1nc2ccccc2n1C |
| InChI | InChI=1S/C17H25N3/c1-12(14-8-4-5-9-14)18-13(2)17-19-15-10-6-7-11-16(15)20(17)3/h6-7,10-14,18H,4-5,8-9H2,1-3H3/t12-,13?/m1/s1 |
| InChIKey | UZTSQUNPDQGKGS-PZORYLMUSA-N |
| XLogP | 3.80 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |