C12H18BrN3O2S — CID 138025441
1-(4-bromothiophen-3-yl)-3-[2-(2-methylmorpholin-4-yl)ethyl]urea (PubChem CID 138025441) has the molecular formula C12H18BrN3O2S and a molecular weight of 348.27 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-3-[2-(2-methylmorpholin-4-yl)ethyl]urea.
| Compound Name | 1-(4-bromothiophen-3-yl)-3-[2-(2-methylmorpholin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 138025441 |
| Molecular Formula | C12H18BrN3O2S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-3-[2-(2-methylmorpholin-4-yl)ethyl]urea |
| SMILES | CC1CN(CCNC(=O)Nc2cscc2Br)CCO1 |
| InChI | InChI=1S/C12H18BrN3O2S/c1-9-6-16(4-5-18-9)3-2-14-12(17)15-11-8-19-7-10(11)13/h7-9H,2-6H2,1H3,(H2,14,15,17) |
| InChIKey | DJQPHMMIQIKEAE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |