C14H18F3N3O2 — CID 138004708
N-[2-(2-methylmorpholin-4-yl)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 138004708) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[2-(2-methylmorpholin-4-yl)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(2-methylmorpholin-4-yl)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138004708 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-(2-methylmorpholin-4-yl)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC1CN(CCNC(=O)c2cnccc2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C14H18F3N3O2/c1-10-9-20(6-7-22-10)5-4-19-13(21)11-8-18-3-2-12(11)14(15,16)17/h2-3,8,10H,4-7,9H2,1H3,(H,19,21) |
| InChIKey | SIZWMRPFBJVXDM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |