C12H15N5O2 — CID 138025676
1-(6-methoxy-2-pyridinyl)-3-[2-(1H-pyrazol-4-yl)ethyl]urea (PubChem CID 138025676) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-(6-methoxy-2-pyridinyl)-3-[2-(1H-pyrazol-4-yl)ethyl]urea.
| Compound Name | 1-(6-methoxy-2-pyridinyl)-3-[2-(1H-pyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 138025676 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-(6-methoxy-2-pyridinyl)-3-[2-(1H-pyrazol-4-yl)ethyl]urea |
| SMILES | COc1cccc(NC(=O)NCCc2cn[nH]c2)n1 |
| InChI | InChI=1S/C12H15N5O2/c1-19-11-4-2-3-10(16-11)17-12(18)13-6-5-9-7-14-15-8-9/h2-4,7-8H,5-6H2,1H3,(H,14,15)(H2,13,16,17,18) |
| InChIKey | IXQFRMXGYGSUFL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |