C10H14ClN3O2 — CID 142435091
N-(6-methoxy-2-pyridinyl)azetidine-3-carboxamide;hydrochloride (PubChem CID 142435091) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is N-(6-methoxy-2-pyridinyl)azetidine-3-carboxamide;hydrochloride.
| Compound Name | N-(6-methoxy-2-pyridinyl)azetidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142435091 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-(6-methoxy-2-pyridinyl)azetidine-3-carboxamide;hydrochloride |
| SMILES | COc1cccc(NC(=O)C2CNC2)n1.Cl |
| InChI | InChI=1S/C10H13N3O2.ClH/c1-15-9-4-2-3-8(12-9)13-10(14)7-5-11-6-7;/h2-4,7,11H,5-6H2,1H3,(H,12,13,14);1H |
| InChIKey | IMULUBWBHPQXAP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |