C18H24N4O2 — CID 138026346
5-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 138026346) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 138026346 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 5-[[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(CN3C[C@@H]4CN(C)C[C@]4(C)C3)n2)cc1 |
| InChI | InChI=1S/C18H24N4O2/c1-18-11-21(2)8-14(18)9-22(12-18)10-16-19-17(20-24-16)13-4-6-15(23-3)7-5-13/h4-7,14H,8-12H2,1-3H3/t14-,18+/m0/s1 |
| InChIKey | JFWIMLYAVNRYSU-KBXCAEBGSA-N |
| XLogP | 2.13 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |