C21H24N4O — CID 138026361
1-[(1-methylpyrrolidin-3-yl)methyl]-3-(2-phenyl-1H-indol-3-yl)urea (PubChem CID 138026361) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[(1-methylpyrrolidin-3-yl)methyl]-3-(2-phenyl-1H-indol-3-yl)urea.
| Compound Name | 1-[(1-methylpyrrolidin-3-yl)methyl]-3-(2-phenyl-1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 138026361 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[(1-methylpyrrolidin-3-yl)methyl]-3-(2-phenyl-1H-indol-3-yl)urea |
| SMILES | CN1CCC(CNC(=O)Nc2c(-c3ccccc3)[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C21H24N4O/c1-25-12-11-15(14-25)13-22-21(26)24-20-17-9-5-6-10-18(17)23-19(20)16-7-3-2-4-8-16/h2-10,15,23H,11-14H2,1H3,(H2,22,24,26) |
| InChIKey | YGZHOHANNZFPGB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |