C16H26N6O2 — CID 138027854
(3aR,6aR)-2-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide (PubChem CID 138027854) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (3aR,6aR)-2-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide.
| Compound Name | (3aR,6aR)-2-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide |
|---|---|
| PubChem CID | 138027854 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (3aR,6aR)-2-N-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide |
| SMILES | CN(C)CCn1cc(NC(=O)N2C[C@@H]3CCC[C@]3(C(N)=O)C2)cn1 |
| InChI | InChI=1S/C16H26N6O2/c1-20(2)6-7-22-10-13(8-18-22)19-15(24)21-9-12-4-3-5-16(12,11-21)14(17)23/h8,10,12H,3-7,9,11H2,1-2H3,(H2,17,23)(H,19,24)/t12-,16-/m0/s1 |
| InChIKey | PALSVROUEOQOOH-LRDDRELGSA-N |
| XLogP | 0.56 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |