C14H25N5OS — CID 71853293
1-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3-[(2-methylthiolan-2-yl)methyl]urea (PubChem CID 71853293) has the molecular formula C14H25N5OS and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3-[(2-methylthiolan-2-yl)methyl]urea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3-[(2-methylthiolan-2-yl)methyl]urea |
|---|---|
| PubChem CID | 71853293 |
| Molecular Formula | C14H25N5OS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-3-[(2-methylthiolan-2-yl)methyl]urea |
| SMILES | CN(C)CCn1cc(NC(=O)NCC2(C)CCCS2)cn1 |
| InChI | InChI=1S/C14H25N5OS/c1-14(5-4-8-21-14)11-15-13(20)17-12-9-16-19(10-12)7-6-18(2)3/h9-10H,4-8,11H2,1-3H3,(H2,15,17,20) |
| InChIKey | GNZOEVSHGDLHQD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |