C20H28N2O — CID 138030571
1-azabicyclo[3.3.1]nonan-5-yl-[3-(2-methylphenyl)pyrrolidin-1-yl]methanone (PubChem CID 138030571) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-azabicyclo[3.3.1]nonan-5-yl-[3-(2-methylphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | 1-azabicyclo[3.3.1]nonan-5-yl-[3-(2-methylphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 138030571 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-azabicyclo[3.3.1]nonan-5-yl-[3-(2-methylphenyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccccc1C1CCN(C(=O)C23CCCN(CCC2)C3)C1 |
| InChI | InChI=1S/C20H28N2O/c1-16-6-2-3-7-18(16)17-8-13-22(14-17)19(23)20-9-4-11-21(15-20)12-5-10-20/h2-3,6-7,17H,4-5,8-15H2,1H3 |
| InChIKey | ZFIDNVJHMMKOLW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |