C20H27F2N3O3 — CID 138031579
N-[1-[3-[4-(difluoromethyl)phenyl]propanoyl]piperidin-4-yl]morpholine-4-carboxamide (PubChem CID 138031579) has the molecular formula C20H27F2N3O3 and a molecular weight of 395.45 g/mol. Its IUPAC name is N-[1-[3-[4-(difluoromethyl)phenyl]propanoyl]piperidin-4-yl]morpholine-4-carboxamide.
| Compound Name | N-[1-[3-[4-(difluoromethyl)phenyl]propanoyl]piperidin-4-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 138031579 |
| Molecular Formula | C20H27F2N3O3 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[1-[3-[4-(difluoromethyl)phenyl]propanoyl]piperidin-4-yl]morpholine-4-carboxamide |
| SMILES | O=C(CCc1ccc(C(F)F)cc1)N1CCC(NC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H27F2N3O3/c21-19(22)16-4-1-15(2-5-16)3-6-18(26)24-9-7-17(8-10-24)23-20(27)25-11-13-28-14-12-25/h1-2,4-5,17,19H,3,6-14H2,(H,23,27) |
| InChIKey | QAEZYGJTSCSJEX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |