C17H21ClN4O — CID 138032089
3-[(4-chloro-3,3-dimethyl-2H-indol-1-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepine (PubChem CID 138032089) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 3-[(4-chloro-3,3-dimethyl-2H-indol-1-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepine.
| Compound Name | 3-[(4-chloro-3,3-dimethyl-2H-indol-1-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepine |
|---|---|
| PubChem CID | 138032089 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-[(4-chloro-3,3-dimethyl-2H-indol-1-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepine |
| SMILES | CC1(C)CN(Cc2nnc3n2CCOCC3)c2cccc(Cl)c21 |
| InChI | InChI=1S/C17H21ClN4O/c1-17(2)11-21(13-5-3-4-12(18)16(13)17)10-15-20-19-14-6-8-23-9-7-22(14)15/h3-5H,6-11H2,1-2H3 |
| InChIKey | TWAMMPGPDQQVHT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |