About 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one
2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one (PubChem CID 138032932) has the molecular formula C13H16N4OS
and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one |
| PubChem CID | 138032932 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one |
| SMILES | CC(NCc1cc(=O)[nH]c(C2CC2)n1)c1cscn1 |
| InChI | InChI=1S/C13H16N4OS/c1-8(11-6-19-7-15-11)14-5-10-4-12(18)17-13(16-10)9-2-3-9/h4,6-9,14H,2-3,5H2,1H3,(H,16,17,18) |
| InChIKey | LFJPEHICSRKOHQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one?
The IUPAC name of 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one (CID 138032932) is 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one.
What is the SMILES notation for 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one?
The canonical SMILES for 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one is CC(NCc1cc(=O)[nH]c(C2CC2)n1)c1cscn1.
What is the InChIKey of 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one?
The InChIKey is LFJPEHICSRKOHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4OS/c1-8(11-6-19-7-15-11)14-5-10-4-12(18)17-13(16-10)9-2-3-9/h4,6-9,14H,2-3,5H2,1H3,(H,16,17,18).
What are the key properties of 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one?
2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one has a molecular weight of 276.36 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]-1H-pyrimidin-6-one is sourced from PubChem (CID 138032932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).