C17H20F2N4O — CID 138034005
[2-(difluoromethyl)pyrazol-3-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone (PubChem CID 138034005) has the molecular formula C17H20F2N4O and a molecular weight of 334.37 g/mol. Its IUPAC name is [2-(difluoromethyl)pyrazol-3-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone.
| Compound Name | [2-(difluoromethyl)pyrazol-3-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 138034005 |
| Molecular Formula | C17H20F2N4O |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [2-(difluoromethyl)pyrazol-3-yl]-[4-(2-phenylethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccnn1C(F)F)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H20F2N4O/c18-17(19)23-15(6-8-20-23)16(24)22-12-10-21(11-13-22)9-7-14-4-2-1-3-5-14/h1-6,8,17H,7,9-13H2 |
| InChIKey | IFERIUICYVMDSK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |