C16H17ClF2N4O — CID 19479124
[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-[2-(difluoromethyl)pyrazol-3-yl]methanone (PubChem CID 19479124) has the molecular formula C16H17ClF2N4O and a molecular weight of 354.79 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)methyl]piperazin-1-yl]-[2-(difluoromethyl)pyrazol-3-yl]methanone.
| Compound Name | [4-[(4-chlorophenyl)methyl]piperazin-1-yl]-[2-(difluoromethyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 19479124 |
| Molecular Formula | C16H17ClF2N4O |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [4-[(4-chlorophenyl)methyl]piperazin-1-yl]-[2-(difluoromethyl)pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccnn1C(F)F)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H17ClF2N4O/c17-13-3-1-12(2-4-13)11-21-7-9-22(10-8-21)15(24)14-5-6-20-23(14)16(18)19/h1-6,16H,7-11H2 |
| InChIKey | CWLNTFYVWMCERT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |