C15H21ClN4O2 — CID 138034235
4-chloro-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-methylpyrazole-5-carboxamide (PubChem CID 138034235) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 4-chloro-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 138034235 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-chloro-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1c(Cl)cnn1C)c1ccco1 |
| InChI | InChI=1S/C15H21ClN4O2/c1-4-20(5-2)12(13-7-6-8-22-13)10-17-15(21)14-11(16)9-18-19(14)3/h6-9,12H,4-5,10H2,1-3H3,(H,17,21) |
| InChIKey | DCGJKZZFSNGEMQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |