C17H25N3O4 — CID 51095697
N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 51095697) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 51095697 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CCN(CC)C(CNC(=O)CCN1C(=O)CCC1=O)c1ccco1 |
| InChI | InChI=1S/C17H25N3O4/c1-3-19(4-2)13(14-6-5-11-24-14)12-18-15(21)9-10-20-16(22)7-8-17(20)23/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,18,21) |
| InChIKey | PAKSTIKHKPLDBD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|