C18H25N5O — CID 138034610
2-methyl-N-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]-2-pyrazol-1-ylpropanamide (PubChem CID 138034610) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-methyl-N-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]-2-pyrazol-1-ylpropanamide.
| Compound Name | 2-methyl-N-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 138034610 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 2-methyl-N-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]-2-pyrazol-1-ylpropanamide |
| SMILES | Cc1ccc(N2CCC(NC(=O)C(C)(C)n3cccn3)CC2)nc1 |
| InChI | InChI=1S/C18H25N5O/c1-14-5-6-16(19-13-14)22-11-7-15(8-12-22)21-17(24)18(2,3)23-10-4-9-20-23/h4-6,9-10,13,15H,7-8,11-12H2,1-3H3,(H,21,24) |
| InChIKey | ILTAGGGXXIDPEH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |