C11H11F2NO6S — CID 138037993
2-[3-(2,2-difluoroethylsulfonylcarbamoyl)phenoxy]acetic acid (PubChem CID 138037993) has the molecular formula C11H11F2NO6S and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethylsulfonylcarbamoyl)phenoxy]acetic acid.
| Compound Name | 2-[3-(2,2-difluoroethylsulfonylcarbamoyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 138037993 |
| Molecular Formula | C11H11F2NO6S |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[3-(2,2-difluoroethylsulfonylcarbamoyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C(=O)NS(=O)(=O)CC(F)F)c1 |
| InChI | InChI=1S/C11H11F2NO6S/c12-9(13)6-21(18,19)14-11(17)7-2-1-3-8(4-7)20-5-10(15)16/h1-4,9H,5-6H2,(H,14,17)(H,15,16) |
| InChIKey | NCTFLRBZHHPWSE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |