C14H21NO2 — CID 138039709
tert-butyl 8-ethynyl-6-azabicyclo[3.2.1]octane-6-carboxylate (PubChem CID 138039709) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is tert-butyl 8-ethynyl-6-azabicyclo[3.2.1]octane-6-carboxylate.
| Compound Name | tert-butyl 8-ethynyl-6-azabicyclo[3.2.1]octane-6-carboxylate |
|---|---|
| PubChem CID | 138039709 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | tert-butyl 8-ethynyl-6-azabicyclo[3.2.1]octane-6-carboxylate |
| SMILES | C#CC1C2CCCC1N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C14H21NO2/c1-5-11-10-7-6-8-12(11)15(9-10)13(16)17-14(2,3)4/h1,10-12H,6-9H2,2-4H3 |
| InChIKey | KTIFJSCMYOWVAO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|