C8H14N4O — CID 138040609
[1-(oxan-4-yl)pyrazol-3-yl]hydrazine (PubChem CID 138040609) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is [1-(oxan-4-yl)pyrazol-3-yl]hydrazine.
| Compound Name | [1-(oxan-4-yl)pyrazol-3-yl]hydrazine |
|---|---|
| PubChem CID | 138040609 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | [1-(oxan-4-yl)pyrazol-3-yl]hydrazine |
| SMILES | NNc1ccn(C2CCOCC2)n1 |
| InChI | InChI=1S/C8H14N4O/c9-10-8-1-4-12(11-8)7-2-5-13-6-3-7/h1,4,7H,2-3,5-6,9H2,(H,10,11) |
| InChIKey | SINFFOPRQUJXEU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|