C10H16F3N3O — CID 82789571
1-[3-(4,4,4-trifluorobutoxy)propyl]pyrazol-3-amine (PubChem CID 82789571) has the molecular formula C10H16F3N3O and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-[3-(4,4,4-trifluorobutoxy)propyl]pyrazol-3-amine.
| Compound Name | 1-[3-(4,4,4-trifluorobutoxy)propyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 82789571 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-[3-(4,4,4-trifluorobutoxy)propyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCCOCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H16F3N3O/c11-10(12,13)4-1-7-17-8-2-5-16-6-3-9(14)15-16/h3,6H,1-2,4-5,7-8H2,(H2,14,15) |
| InChIKey | GPXDUQAEBKDFQG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|