C15H18N2O5S — CID 138042035
2-[furan-3-ylsulfonyl(pyridin-2-ylmethyl)amino]-3-methylbutanoic acid (PubChem CID 138042035) has the molecular formula C15H18N2O5S and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-[furan-3-ylsulfonyl(pyridin-2-ylmethyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[furan-3-ylsulfonyl(pyridin-2-ylmethyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 138042035 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[furan-3-ylsulfonyl(pyridin-2-ylmethyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(Cc1ccccn1)S(=O)(=O)c1ccoc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-11(2)14(15(18)19)17(9-12-5-3-4-7-16-12)23(20,21)13-6-8-22-10-13/h3-8,10-11,14H,9H2,1-2H3,(H,18,19) |
| InChIKey | LCVPKBIZIUZQBX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |