C21H34N4O3 — CID 138044335
1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-1-methyl-3-(2-morpholin-4-ylpropyl)urea (PubChem CID 138044335) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-1-methyl-3-(2-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-1-methyl-3-(2-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 138044335 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-1-methyl-3-(2-morpholin-4-ylpropyl)urea |
| SMILES | CC(CNC(=O)N(C)CC1(O)CCN(Cc2ccccc2)C1)N1CCOCC1 |
| InChI | InChI=1S/C21H34N4O3/c1-18(25-10-12-28-13-11-25)14-22-20(26)23(2)16-21(27)8-9-24(17-21)15-19-6-4-3-5-7-19/h3-7,18,27H,8-17H2,1-2H3,(H,22,26) |
| InChIKey | RBLMKFGQBJZXJN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |