C14H19NO4S — CID 138044685
N-(4-methyloxan-4-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 138044685) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(4-methyloxan-4-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(4-methyloxan-4-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 138044685 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(4-methyloxan-4-yl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2ccc3c(c2)CCO3)CCOCC1 |
| InChI | InChI=1S/C14H19NO4S/c1-14(5-8-18-9-6-14)15-20(16,17)12-2-3-13-11(10-12)4-7-19-13/h2-3,10,15H,4-9H2,1H3 |
| InChIKey | XSVSRDLOHXNSOD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |