C12H22FN3O3 — CID 138045234
3-fluoropropyl 4-[2-(methylamino)-2-oxoethyl]-1,4-diazepane-1-carboxylate (PubChem CID 138045234) has the molecular formula C12H22FN3O3 and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-fluoropropyl 4-[2-(methylamino)-2-oxoethyl]-1,4-diazepane-1-carboxylate.
| Compound Name | 3-fluoropropyl 4-[2-(methylamino)-2-oxoethyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 138045234 |
| Molecular Formula | C12H22FN3O3 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-fluoropropyl 4-[2-(methylamino)-2-oxoethyl]-1,4-diazepane-1-carboxylate |
| SMILES | CNC(=O)CN1CCCN(C(=O)OCCCF)CC1 |
| InChI | InChI=1S/C12H22FN3O3/c1-14-11(17)10-15-5-3-6-16(8-7-15)12(18)19-9-2-4-13/h2-10H2,1H3,(H,14,17) |
| InChIKey | DQQSHZYWFYXBSF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|