C13H14N2O4S — CID 138045412
3-[(2-cyano-3-methylphenyl)sulfonylamino]cyclobutane-1-carboxylic acid (PubChem CID 138045412) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[(2-cyano-3-methylphenyl)sulfonylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[(2-cyano-3-methylphenyl)sulfonylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 138045412 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[(2-cyano-3-methylphenyl)sulfonylamino]cyclobutane-1-carboxylic acid |
| SMILES | Cc1cccc(S(=O)(=O)NC2CC(C(=O)O)C2)c1C#N |
| InChI | InChI=1S/C13H14N2O4S/c1-8-3-2-4-12(11(8)7-14)20(18,19)15-10-5-9(6-10)13(16)17/h2-4,9-10,15H,5-6H2,1H3,(H,16,17) |
| InChIKey | HBOAQFFBENLKEC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |