C19H21FN6O3S — CID 138046391
1-[(3-ethyltriazol-4-yl)methyl]-3-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]urea (PubChem CID 138046391) has the molecular formula C19H21FN6O3S and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-[(3-ethyltriazol-4-yl)methyl]-3-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]urea.
| Compound Name | 1-[(3-ethyltriazol-4-yl)methyl]-3-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 138046391 |
| Molecular Formula | C19H21FN6O3S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[(3-ethyltriazol-4-yl)methyl]-3-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]urea |
| SMILES | CCn1nncc1CNC(=O)NCc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN6O3S/c1-2-26-17(13-23-25-26)12-22-19(27)21-11-14-3-9-18(10-4-14)30(28,29)24-16-7-5-15(20)6-8-16/h3-10,13,24H,2,11-12H2,1H3,(H2,21,22,27) |
| InChIKey | ZIUWGYHDCDIZHE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |