C15H19ClN4O2 — CID 138049627
3-[(4-chloro-2-methoxyphenyl)methyl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]urea (PubChem CID 138049627) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is 3-[(4-chloro-2-methoxyphenyl)methyl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]urea.
| Compound Name | 3-[(4-chloro-2-methoxyphenyl)methyl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 138049627 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-[(4-chloro-2-methoxyphenyl)methyl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]urea |
| SMILES | COc1cc(Cl)ccc1CNC(=O)N(C)Cc1ccn(C)n1 |
| InChI | InChI=1S/C15H19ClN4O2/c1-19(10-13-6-7-20(2)18-13)15(21)17-9-11-4-5-12(16)8-14(11)22-3/h4-8H,9-10H2,1-3H3,(H,17,21) |
| InChIKey | NYVYTKVLAXNGTL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |