C16H20N2O3 — CID 138050274
3-[3-[(4-methyl-1,2-oxazol-3-yl)methylamino]phenyl]propyl acetate (PubChem CID 138050274) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[3-[(4-methyl-1,2-oxazol-3-yl)methylamino]phenyl]propyl acetate.
| Compound Name | 3-[3-[(4-methyl-1,2-oxazol-3-yl)methylamino]phenyl]propyl acetate |
|---|---|
| PubChem CID | 138050274 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[3-[(4-methyl-1,2-oxazol-3-yl)methylamino]phenyl]propyl acetate |
| SMILES | CC(=O)OCCCc1cccc(NCc2nocc2C)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-12-11-21-18-16(12)10-17-15-7-3-5-14(9-15)6-4-8-20-13(2)19/h3,5,7,9,11,17H,4,6,8,10H2,1-2H3 |
| InChIKey | QENPMWKMPCIKGN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|