C15H18F3N3O3 — CID 138050957
4-methyl-5-oxo-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperazine-2-carboxamide (PubChem CID 138050957) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 4-methyl-5-oxo-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperazine-2-carboxamide.
| Compound Name | 4-methyl-5-oxo-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 138050957 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 4-methyl-5-oxo-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperazine-2-carboxamide |
| SMILES | CN1CC(C(=O)NCCc2ccc(OC(F)(F)F)cc2)NCC1=O |
| InChI | InChI=1S/C15H18F3N3O3/c1-21-9-12(20-8-13(21)22)14(23)19-7-6-10-2-4-11(5-3-10)24-15(16,17)18/h2-5,12,20H,6-9H2,1H3,(H,19,23) |
| InChIKey | OSNRPZGUJYHMQO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |