C17H21F3N2O4 — CID 93018135
(3S)-N-(3-methoxypropyl)-5-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 93018135) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is (3S)-N-(3-methoxypropyl)-5-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(3-methoxypropyl)-5-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93018135 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (3S)-N-(3-methoxypropyl)-5-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1CC(=O)N(Cc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H21F3N2O4/c1-25-8-2-7-21-16(24)13-9-15(23)22(11-13)10-12-3-5-14(6-4-12)26-17(18,19)20/h3-6,13H,2,7-11H2,1H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | MRMSMVXKXMUEGZ-ZDUSSCGKSA-N |
| XLogP | 2.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|