C17H18F6N2O3 — CID 93018072
(3S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 93018072) has the molecular formula C17H18F6N2O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is (3S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93018072 |
| Molecular Formula | C17H18F6N2O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (3S)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CC(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H18F6N2O3/c1-28-3-2-24-15(27)11-6-14(26)25(9-11)8-10-4-12(16(18,19)20)7-13(5-10)17(21,22)23/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,24,27)/t11-/m0/s1 |
| InChIKey | VXVBWVLAFWTYDE-NSHDSACASA-N |
| XLogP | 2.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|