C22H23F3N2O4 — CID 55763241
N-[4-(2-methoxyethoxy)phenyl]-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 55763241) has the molecular formula C22H23F3N2O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)phenyl]-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[4-(2-methoxyethoxy)phenyl]-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55763241 |
| Molecular Formula | C22H23F3N2O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[4-(2-methoxyethoxy)phenyl]-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)C2CC(=O)N(Cc3cccc(C(F)(F)F)c3)C2)cc1 |
| InChI | InChI=1S/C22H23F3N2O4/c1-30-9-10-31-19-7-5-18(6-8-19)26-21(29)16-12-20(28)27(14-16)13-15-3-2-4-17(11-15)22(23,24)25/h2-8,11,16H,9-10,12-14H2,1H3,(H,26,29) |
| InChIKey | NLOUOQZZJDBVSM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|