C21H17F3N2O2 — CID 46485210
N-(3-ethynylphenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 46485210) has the molecular formula C21H17F3N2O2 and a molecular weight of 386.37 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46485210 |
| Molecular Formula | C21H17F3N2O2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-(3-ethynylphenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)C2CC(=O)N(Cc3cccc(C(F)(F)F)c3)C2)c1 |
| InChI | InChI=1S/C21H17F3N2O2/c1-2-14-5-4-8-18(10-14)25-20(28)16-11-19(27)26(13-16)12-15-6-3-7-17(9-15)21(22,23)24/h1,3-10,16H,11-13H2,(H,25,28) |
| InChIKey | AARLVKCEXKTVRY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|