C19H16F3IN2O2 — CID 55738631
N-(2-iodophenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 55738631) has the molecular formula C19H16F3IN2O2 and a molecular weight of 488.25 g/mol. Its IUPAC name is N-(2-iodophenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-(2-iodophenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55738631 |
| Molecular Formula | C19H16F3IN2O2 |
| Molecular Weight | 488.25 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | N-(2-iodophenyl)-5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1I)C1CC(=O)N(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H16F3IN2O2/c20-19(21,22)14-5-3-4-12(8-14)10-25-11-13(9-17(25)26)18(27)24-16-7-2-1-6-15(16)23/h1-8,13H,9-11H2,(H,24,27) |
| InChIKey | KXZDEEFMFBQMFX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|