About (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one
(E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 138051042) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one |
| PubChem CID | 138051042 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | C/C(=C\c1ccc(C)cc1)C(=O)N1CCOC12CCOCC2 |
| InChI | InChI=1S/C18H23NO3/c1-14-3-5-16(6-4-14)13-15(2)17(20)19-9-12-22-18(19)7-10-21-11-8-18/h3-6,13H,7-12H2,1-2H3/b15-13+ |
| InChIKey | VGENJQSSAJXIIP-FYWRMAATSA-N |
| XLogP | 2.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one?
The IUPAC name of (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one (CID 138051042) is (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one?
The canonical SMILES for (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one is C/C(=C\c1ccc(C)cc1)C(=O)N1CCOC12CCOCC2.
What is the InChIKey of (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one?
The InChIKey is VGENJQSSAJXIIP-FYWRMAATSA-N. The full InChI is InChI=1S/C18H23NO3/c1-14-3-5-16(6-4-14)13-15(2)17(20)19-9-12-22-18(19)7-10-21-11-8-18/h3-6,13H,7-12H2,1-2H3/b15-13+.
What are the key properties of (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one?
(E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one has a molecular weight of 301.39 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(1,8-dioxa-4-azaspiro[4.5]decan-4-yl)-2-methyl-3-(4-methylphenyl)prop-2-en-1-one is sourced from PubChem (CID 138051042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).