C15H21ClN6 — CID 138052166
N-[[1-[(5-chloro-2-pyridinyl)methyl]triazol-4-yl]methyl]-1-methylpiperidin-4-amine (PubChem CID 138052166) has the molecular formula C15H21ClN6 and a molecular weight of 320.83 g/mol. Its IUPAC name is N-[[1-[(5-chloro-2-pyridinyl)methyl]triazol-4-yl]methyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[[1-[(5-chloro-2-pyridinyl)methyl]triazol-4-yl]methyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 138052166 |
| Molecular Formula | C15H21ClN6 |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[[1-[(5-chloro-2-pyridinyl)methyl]triazol-4-yl]methyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NCc2cn(Cc3ccc(Cl)cn3)nn2)CC1 |
| InChI | InChI=1S/C15H21ClN6/c1-21-6-4-13(5-7-21)18-9-15-11-22(20-19-15)10-14-3-2-12(16)8-17-14/h2-3,8,11,13,18H,4-7,9-10H2,1H3 |
| InChIKey | HYPNFXHXTUQKIC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |