C12H14F3N5O2S — CID 138052554
2-cyclobutyl-N-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]pyrazole-3-sulfonamide (PubChem CID 138052554) has the molecular formula C12H14F3N5O2S and a molecular weight of 349.34 g/mol. Its IUPAC name is 2-cyclobutyl-N-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]pyrazole-3-sulfonamide.
| Compound Name | 2-cyclobutyl-N-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 138052554 |
| Molecular Formula | C12H14F3N5O2S |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-cyclobutyl-N-[4-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]pyrazole-3-sulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccnn2C2CCC2)n[nH]c1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N5O2S/c1-7-10(12(13,14)15)17-18-11(7)19-23(21,22)9-5-6-16-20(9)8-3-2-4-8/h5-6,8H,2-4H2,1H3,(H2,17,18,19) |
| InChIKey | HZFLTEHIBBXZTO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |