C14H15F2N3O2S — CID 146143784
N-(2-cyclobutylpyrazol-3-yl)-2-(difluoromethyl)benzenesulfonamide (PubChem CID 146143784) has the molecular formula C14H15F2N3O2S and a molecular weight of 327.36 g/mol. Its IUPAC name is N-(2-cyclobutylpyrazol-3-yl)-2-(difluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-cyclobutylpyrazol-3-yl)-2-(difluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 146143784 |
| Molecular Formula | C14H15F2N3O2S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(2-cyclobutylpyrazol-3-yl)-2-(difluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccnn1C1CCC1)c1ccccc1C(F)F |
| InChI | InChI=1S/C14H15F2N3O2S/c15-14(16)11-6-1-2-7-12(11)22(20,21)18-13-8-9-17-19(13)10-4-3-5-10/h1-2,6-10,14,18H,3-5H2 |
| InChIKey | SADGXFCQIHJYMQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |